검색결과 : 1건
| No. | Article |
|---|---|
| 1 |
Ionothermal synthesis of metal oxalatophosphonates with a three-dimensional framework structure: Na2M3(C2O4)(3)(CH3PO3H)(2) (M = Fe-II and Mn-II) Tsao CP, Sheu CY, Nguyen N, Lii KH Inorganic Chemistry, 45(16), 6361, 2006 |
| No. | Article |
|---|---|
| 1 |
Ionothermal synthesis of metal oxalatophosphonates with a three-dimensional framework structure: Na2M3(C2O4)(3)(CH3PO3H)(2) (M = Fe-II and Mn-II) Tsao CP, Sheu CY, Nguyen N, Lii KH Inorganic Chemistry, 45(16), 6361, 2006 |