Inorganic Chemistry, Vol.52, No.4, 1872-1882, 2013
Novel Trialkanolamine Derivatives of Tin of the Type [N(CH2CMe2O)(2)(CH2)(n)OSnOR](m) (m=1, 2; n=2, 3; R = t-Bu, 2,6-Me2C6H3) and Related Tri- and Pentanuclear Tin(IV) Oxoclusters. Syntheses and Molecular Structures
The syntheses of the novel alkanolamine N-(CH2CMe2OH)(2)(CH2CH2CH2OH) (2), the novel aminotrialkoxides of tin of the type [N-(CH2CMe2O)(2)(CH2)(n)OSnOR](m) (3: m = 1, n = 2, R = t-Bu; 4: m = 2, n = 3, R = t-Bu; 5: m = n = 2, R = 2,6-Me2C6H3; 6: m = 2, n = 3, R = 2,6-Me2C6H3) and the related trinuclear tin oxoclusters [(LSnOSnL)(LSnOR)] [L = N-(CH2CMe2O)(2)(CH2CH2O), 7: R = t-Bu; 8: R = 2,6-Me2C6H3] and the pentanuclear tin oxocluster [LSnOSn-(OH)(2)OSnL center dot 2LSnOH], [9, L = N(CH2CMe2O)(2)(CH2CH2O)] are reported. The compounds are characterized by elemental analyses, multinuclear (H-1, C-13, Sn-119, H-1-H-1 cosy, H-1-C-13 HSQC) NMR spectroscopy, electrospray ionization mass spectrometry, and single crystal X-ray diffraction analyses (3, 4 center dot C7H8, 5, 7, 8 center dot 0.5C(7)H(8), 9 center dot 6H(2)O).