Materials Research Bulletin, Vol.35, No.12, 1933-1944, 2000
Preparation and structure of a series of cyclohexaphosphates: M(p-CH3C6H4NH3)(4)P6O18 center dot 8H(2)O (M = Cd, Co, Zn, and Cu)
Four new cyclohexaphosphates with the general formula M(p-CH3C6H4NH3)(4)P6O18. 8H(2)O (M: Cd, Co, Zn, and Cu) are reported. They crystallize with triclinic unit cells and are isotopic. As an example, we give the parameters of Cd(p-CH3C6H4NH3)(4)P6O18. 8H(2)O: a = 13.834(2), b = 9.974(2), c = 9.134(1) Angstrom, alpha = 108.12(1), beta = 91.93(1), gamma = 93.45(1)degrees, Z = 1, P (1) over bar, V = 1193.9(6) Angstrom (3), and D-x = 1.618 g.cm(-3). The crystal structure was determined using 5214 independent reflections with a final R = 0.027. The atomic arrangement can be described as layers built up by P6O186-, ring anions, Cd cations, and water molecules, parallel to the (100) planes. Organic cations are located between these layers.
Keywords:chemical synthesis;infrared spectroscopy;thermogravimetric analysis (TGA);X-ray diffraction;crystal structure