Reactions of Pd-3(OAc)(6) with lithium salts of mononegative bidentate N,N-ligands, L, of various types, such as formamidinates, benzamidinates, triazinates, and guanidinates, were investigated in a search for ways to obtain Pd-2(4+) compounds that could serve as precursors to paddlewheel complexes with a metal-metal bond and a Pd-2(5+) core. It was found that the reactions are complex and that either square planar mononuclear or dinuclear species may be formed depending on the reaction conditions or the method of isolation. For Pd2L4 compounds, alpha and beta isomers were sometimes obtainable. In the a isomer, all N,N-ligands serve as bridges, whereas in the P isomer, two ligands bridge the Pd-2(4+) unit and each of the other two chelate to a metal atom. Electrochemistry shows that the paddlewheel compounds Pd-2(ToINC(H)NTol)(4), Pd-2(PhNC(Ph)NPh)(4), and Pd-2(PhNC(Ph)NPh)(3)(OAc) and the orthometalated complex cis-Pd-2[eta(2)-C6H4NC(Ph)N(H)Ph](2)(mu-OAc)(2) have reversible oxidation waves between 0.70 and 0.92 V vs Ag/AgCl, which makes them good candidates for chemical oxidation.