Macromolecular Rapid Communications, Vol.23, No.13, 776-780, 2002
A new strategy for the synthesis of polytrithiocarbonates using a polymeric support system
A new polymerization strategy, consisting of nucleophilic substitution reaction between CS32-, immobilized on a polymeric support, and dimethyl a,a'-dibromoalkylanedioate in solution, leads to the formation of polytrithiocarbonates. When n = 0, 1 in CH3OOC-CHBr(CH2)nCHBrCOOCH(3) (a,a'-dibromoalkylanedioate), only five-or six-membered cyclic trithiocarbonates were obtained; n greater than or equal to 2 resulted in the formation of polytrithiocarbonates.